Index of /sl/P_Physics/PT_Thermodynamics, statistical physics
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Abe Nonextensive.pdf | 2022-01-19 12:51 | 1.9M | |
![[ ]](/icons/layout.gif) | Abe S., Okamoto Y. (..> | 2022-01-19 12:51 | 1.9M | |
![[IMG]](/icons/image2.gif) | Ahiezer A.I., Peletm..> | 2022-01-19 12:51 | 3.8M | |
![[IMG]](/icons/image2.gif) | Annamalai K., Puri I..> | 2022-01-19 12:51 | 2.5M | |
![[IMG]](/icons/image2.gif) | Aхиезер Методы.djvu | 2022-01-19 12:51 | 3.8M | |
![[IMG]](/icons/image2.gif) | Bahareva I.F. Neline..> | 2022-01-19 12:51 | 1.1M | |
![[IMG]](/icons/image2.gif) | Balescu. Equilibrium..> | 2022-01-19 12:51 | 6.2M | |
![[IMG]](/icons/image2.gif) | Balesku. Tom 1. Ravn..> | 2022-01-19 12:51 | 4.3M | |
![[IMG]](/icons/image2.gif) | Balesku. Tom 2. Ravn..> | 2022-01-19 12:51 | 4.1M | |
![[IMG]](/icons/image2.gif) | Bazarov. Termodinami..> | 2022-01-19 12:51 | 4.2M | |
![[IMG]](/icons/image2.gif) | Bazarov. Termodinami..> | 2022-01-19 12:51 | 5.0M | |
![[IMG]](/icons/image2.gif) | Bergersen B. Statist..> | 2022-01-19 12:51 | 546K | |
![[IMG]](/icons/image2.gif) | Bergersen Statistica..> | 2022-01-19 12:51 | 546K | |
![[IMG]](/icons/image2.gif) | Biot. Variacionnye p..> | 2022-01-19 12:51 | 1.6M | |
![[IMG]](/icons/image2.gif) | Biot. Variacionnye p..> | 2022-01-19 12:51 | 2.1M | |
![[IMG]](/icons/image2.gif) | Bird R.B., Stewart W..> | 2022-01-19 12:51 | 18M | |
![[IMG]](/icons/image2.gif) | Bird Transport.djvu | 2022-01-19 12:51 | 18M | |
![[IMG]](/icons/image2.gif) | Bloch F. Fundamental..> | 2022-01-19 12:51 | 2.4M | |
![[IMG]](/icons/image2.gif) | Bloch F. Fundamental..> | 2022-01-19 12:51 | 2.4M | |
![[IMG]](/icons/image2.gif) | Bogoljubov N.N., Bog..> | 2022-01-19 12:51 | 3.5M | |
![[IMG]](/icons/image2.gif) | Bogoljubov N.N., Bog..> | 2022-01-19 12:51 | 3.5M | |
![[IMG]](/icons/image2.gif) | Bolgarskij A.V., Muh..> | 2022-01-19 12:51 | 4.7M | |
![[IMG]](/icons/image2.gif) | Boon Molecular.djvu | 2022-01-19 12:51 | 4.5M | |
![[IMG]](/icons/image2.gif) | Boon, Yip. Molecular..> | 2022-01-19 12:51 | 4.5M | |
![[IMG]](/icons/image2.gif) | Bryan G.H. Thermodyn..> | 2022-01-19 12:51 | 11M | |
![[IMG]](/icons/image2.gif) | Busse F.H., Mueller ..> | 2022-01-19 12:51 | 12M | |
![[IMG]](/icons/image2.gif) | Chandler D. Introduc..> | 2022-01-19 12:51 | 2.1M | |
![[IMG]](/icons/image2.gif) | Chandrasekhar. Stoch..> | 2022-01-19 12:51 | 4.0M | |
![[IMG]](/icons/image2.gif) | D'Agostini G. Bayesi..> | 2022-01-19 12:51 | 1.2M | |
![[IMG]](/icons/image2.gif) | Dalvit D.A.R., Frast..> | 2022-01-19 12:51 | 2.2M | |
![[IMG]](/icons/image2.gif) | Dalvit Problems.djvu | 2022-01-19 12:51 | 2.2M | |
![[IMG]](/icons/image2.gif) | Dittrich et al. Quan..> | 2022-01-19 12:51 | 4.7M | |
![[IMG]](/icons/image2.gif) | Dorfman J.R. Introdu..> | 2022-01-19 12:51 | 2.3M | |
![[IMG]](/icons/image2.gif) | Dorlas. Statistical ..> | 2022-01-19 12:51 | 2.1M | |
![[IMG]](/icons/image2.gif) | Dugdale Entropy.djvu | 2022-01-19 12:51 | 3.8M | |
![[IMG]](/icons/image2.gif) | Dugdale J.S. Entropy..> | 2022-01-19 12:51 | 3.8M | |
![[ ]](/icons/compressed.gif) | Escobedo Homogeneous.gz | 2022-01-19 12:51 | 131K | |
![[ ]](/icons/layout.gif) | Evans, Searles. Fluc..> | 2022-01-19 12:51 | 807K | |
![[IMG]](/icons/image2.gif) | Fejnman R. Statistic..> | 2022-01-19 12:51 | 3.4M | |
![[IMG]](/icons/image2.gif) | Fejnman R. Statistic..> | 2022-01-19 12:51 | 4.3M | |
![[IMG]](/icons/image2.gif) | Fermi E'. Termodinam..> | 2022-01-19 12:51 | 465K | |
![[IMG]](/icons/image2.gif) | Fermi E'. Termodinam..> | 2022-01-19 12:51 | 798K | |
![[IMG]](/icons/image2.gif) | Fermi E. Thermodynam..> | 2022-01-19 12:51 | 13M | |
![[IMG]](/icons/image2.gif) | Fermi E. Thermodynam..> | 2022-01-19 12:51 | 13M | |
![[IMG]](/icons/image2.gif) | Fermi Thermodynamics..> | 2022-01-19 12:51 | 13M | |
![[ ]](/icons/layout.gif) | Frenkel D. Notes on ..> | 2022-01-19 12:51 | 720K | |
![[ ]](/icons/layout.gif) | Frenkel Notes.pdf | 2022-01-19 12:51 | 720K | |
![[ ]](/icons/layout.gif) | Gallavotti. Statisti..> | 2022-01-19 12:51 | 2.5M | |
![[IMG]](/icons/image2.gif) | Galperin Y.M. Statis..> | 2022-01-19 12:51 | 865K | |
![[IMG]](/icons/image2.gif) | Galperin Y.M. Statis..> | 2022-01-19 12:51 | 865K | |
![[IMG]](/icons/image2.gif) | Gibbs J.W. Elementar..> | 2022-01-19 12:51 | 3.3M | |
![[IMG]](/icons/image2.gif) | Guggenheim E.A. Ther..> | 2022-01-19 12:51 | 3.5M | |
![[IMG]](/icons/image2.gif) | Guggenheim Thermodyn..> | 2022-01-19 12:51 | 3.5M | |
![[IMG]](/icons/image2.gif) | Guggenheim. Thermody..> | 2022-01-19 12:51 | 3.4M | |
![[IMG]](/icons/image2.gif) | Guggenheim. Thermody..> | 2022-01-19 12:51 | 3.4M | |
![[ ]](/icons/compressed.gif) | Hinchin A. Matematic..> | 2022-01-19 12:51 | 511K | |
![[IMG]](/icons/image2.gif) | Huang K. Statistiche..> | 2022-01-19 12:51 | 3.5M | |
![[IMG]](/icons/image2.gif) | Huang K. Statistiche..> | 2022-01-19 12:51 | 3.5M | |
![[IMG]](/icons/image2.gif) | Huang Statistical.djvu | 2022-01-19 12:51 | 3.6M | |
![[IMG]](/icons/image2.gif) | Isihara A. Statistic..> | 2022-01-19 12:51 | 3.0M | |
![[IMG]](/icons/image2.gif) | Isihara A. Statistic..> | 2022-01-19 12:51 | 3.5M | |
![[IMG]](/icons/image2.gif) | Izjumov Ju.A., Skrja..> | 2022-01-19 12:51 | 3.7M | |
![[IMG]](/icons/image2.gif) | Izjumov Ju.A., Skrja..> | 2022-01-19 12:51 | 3.7M | |
![[IMG]](/icons/image2.gif) | Kac M. Veroyatnost' ..> | 2022-01-19 12:51 | 2.3M | |
![[IMG]](/icons/image2.gif) | Kittel' Ch. E'lement..> | 2022-01-19 12:51 | 2.8M | |
![[IMG]](/icons/image2.gif) | Kittel' Ch. Statisti..> | 2022-01-19 12:51 | 3.8M | |
![[IMG]](/icons/image2.gif) | Kittel' Ch. Statisti..> | 2022-01-19 12:51 | 4.7M | |
![[IMG]](/icons/image2.gif) | Kondrat'ev, Romanov...> | 2022-01-19 12:51 | 1.0M | |
![[IMG]](/icons/image2.gif) | Krajnov V.P. Kachest..> | 2022-01-19 12:51 | 1.5M | |
![[IMG]](/icons/image2.gif) | Krylov N.S. Raboty p..> | 2022-01-19 12:51 | 1.6M | |
![[IMG]](/icons/image2.gif) | Kubo R. Statistiches..> | 2022-01-19 12:51 | 3.9M | |
![[IMG]](/icons/image2.gif) | Kubo R. Statistiches..> | 2022-01-19 12:51 | 4.9M | |
![[IMG]](/icons/image2.gif) | Kubo R. Termodinamik..> | 2022-01-19 12:51 | 2.7M | |
![[IMG]](/icons/image2.gif) | Kubo R. Thermodynami..> | 2022-01-19 12:51 | 2.7M | |
![[IMG]](/icons/image2.gif) | Kubo R. Thermodynami..> | 2022-01-19 12:51 | 2.7M | |
![[IMG]](/icons/image2.gif) | Landsberg P. (red.) ..> | 2022-01-19 12:51 | 5.3M | |
![[IMG]](/icons/image2.gif) | Lapeyre B., Pardoux ..> | 2022-01-19 12:51 | 1.4M | |
![[IMG]](/icons/image2.gif) | Lapeyre B., Pardoux ..> | 2022-01-19 12:51 | 1.4M | |
![[IMG]](/icons/image2.gif) | Lassig M., Valeriani..> | 2022-01-19 12:51 | 2.8M | |
![[IMG]](/icons/image2.gif) | Lassig M., Valeriani..> | 2022-01-19 12:51 | 2.8M | |
![[IMG]](/icons/image2.gif) | Leff H.S., Rex A.F. ..> | 2022-01-19 12:51 | 5.5M | |
![[IMG]](/icons/image2.gif) | Leff Maxwell's.djvu | 2022-01-19 12:51 | 5.5M | |
![[IMG]](/icons/image2.gif) | Leontovich M.A. Vved..> | 2022-01-19 12:51 | 4.7M | |
![[IMG]](/icons/image2.gif) | Leontovich M.A. Vved..> | 2022-01-19 12:51 | 5.5M | |
![[IMG]](/icons/image2.gif) | Lieb E. Models in st..> | 2022-01-19 12:51 | 444K | |
![[IMG]](/icons/image2.gif) | Lieb Models.djvu | 2022-01-19 12:51 | 444K | |
![[ ]](/icons/layout.gif) | Lieb, Yngvason. Phys..> | 2022-01-19 12:51 | 707K | |
![[ ]](/icons/layout.gif) | Lieb, Yngvason. Phys..> | 2022-01-19 12:51 | 707K | |
![[ ]](/icons/layout.gif) | Lienhardt, Lienhardt..> | 2022-01-19 12:51 | 7.2M | |
![[IMG]](/icons/image2.gif) | Lienhardt, Lienhardt..> | 2022-01-19 12:51 | 5.4M | |
![[IMG]](/icons/image2.gif) | Lifshic I.M., S.A. G..> | 2022-01-19 12:52 | 8.1M | |
![[IMG]](/icons/image2.gif) | Lindblad. Generators..> | 2022-01-19 12:52 | 127K | |
![[IMG]](/icons/image2.gif) | Lorenc G.A. Lekcii p..> | 2022-01-19 12:52 | 522K | |
![[IMG]](/icons/image2.gif) | Lorenc G.A. Statisti..> | 2022-01-19 12:52 | 516K | |
![[IMG]](/icons/image2.gif) | Mackey M.C. Time's a..> | 2022-01-19 12:52 | 2.8M | |
![[IMG]](/icons/image2.gif) | Mackey Time's.djvu | 2022-01-19 12:52 | 2.8M | |
![[IMG]](/icons/image2.gif) | Mallett M., Blumler ..> | 2022-01-19 12:52 | 395K | |
![[IMG]](/icons/image2.gif) | Mallett Thermal.djvu | 2022-01-19 12:52 | 395K | |
![[IMG]](/icons/image2.gif) | Mecke, Stoyan (eds.)..> | 2022-01-19 12:52 | 3.7M | |
![[IMG]](/icons/image2.gif) | Mecke, Stoyan (eds.)..> | 2022-01-19 12:52 | 3.7M | |
![[ ]](/icons/layout.gif) | Mirlin Statistics.pdf | 2022-01-19 12:52 | 876K | |
![[ ]](/icons/layout.gif) | Mirlin. Statistics o..> | 2022-01-19 12:52 | 876K | |
![[ ]](/icons/compressed.gif) | Nattermann Statistis..> | 2022-01-19 12:52 | 2.8M | |
![[IMG]](/icons/image2.gif) | Nattermann T. Statis..> | 2022-01-19 12:52 | 1.4M | |
![[IMG]](/icons/image2.gif) | Nattermann T. Statis..> | 2022-01-19 12:52 | 1.4M | |
![[ ]](/icons/layout.gif) | Nayak C. Many-Body P..> | 2022-01-19 12:52 | 1.4M | |
![[ ]](/icons/layout.gif) | Nelson E. Dynamical ..> | 2022-01-19 12:52 | 465K | |
![[IMG]](/icons/image2.gif) | Nikolis G., Prigozhi..> | 2022-01-19 12:52 | 8.7M | |
![[IMG]](/icons/image2.gif) | Planck M. Treatise o..> | 2022-01-19 12:52 | 9.0M | |
![[IMG]](/icons/image2.gif) | Planck Triatise.djvu | 2022-01-19 12:52 | 9.0M | |
![[DIR]](/icons/folder.gif) | PTin_Information the..> | 2022-01-19 12:52 | - | |
![[DIR]](/icons/folder.gif) | PTir_Irreversible pr..> | 2022-01-19 12:52 | - | |
![[DIR]](/icons/folder.gif) | PTpt_Phase transitions/ | 2022-01-19 12:52 | - | |
![[DIR]](/icons/folder.gif) | PTqs_Quantum methods/ | 2022-01-19 12:52 | - | |
![[ ]](/icons/compressed.gif) | Quantum methodsCardy..> | 2022-01-19 12:52 | 184K | |
![[ ]](/icons/compressed.gif) | Rau J. Statistical m..> | 2022-01-19 12:52 | 130K | |
![[ ]](/icons/compressed.gif) | Rau. Statistical mec..> | 2022-01-19 12:52 | 130K | |
![[IMG]](/icons/image2.gif) | Reichl L.E. A modern..> | 2022-01-19 12:52 | 8.1M | |
![[IMG]](/icons/image2.gif) | Reichl L.E. A modern..> | 2022-01-19 12:52 | 8.1M | |
![[IMG]](/icons/image2.gif) | Rumer Yu.B., M.V.Ryv..> | 2022-01-19 12:52 | 4.3M | |
![[IMG]](/icons/image2.gif) | Rumer Yu.B., M.V.Ryv..> | 2022-01-19 12:52 | 5.3M | |
![[IMG]](/icons/image2.gif) | Ryue'l' D. Statistic..> | 2022-01-19 12:52 | 3.2M | |
![[IMG]](/icons/image2.gif) | Ryue'l'. Termodinami..> | 2022-01-19 12:52 | 1.0M | |
![[IMG]](/icons/image2.gif) | Ryue'l'. Termodinami..> | 2022-01-19 12:52 | 1.6M | |
![[IMG]](/icons/image2.gif) | Sadovskij M.V. Lekci..> | 2022-01-19 12:52 | 940K | |
![[ ]](/icons/compressed.gif) | Sadovskij. Lekcii po..> | 2022-01-19 12:52 | 1.6M | |
![[IMG]](/icons/image2.gif) | Shryodinger. Lekcii ..> | 2022-01-19 12:52 | 480K | |
![[IMG]](/icons/image2.gif) | Stratonovich R.L. Ne..> | 2022-01-19 12:52 | 4.8M | |
![[IMG]](/icons/image2.gif) | Thermodynamics and s..> | 2022-01-19 12:52 | 391K | |
![[ ]](/icons/unknown.gif) | TRANS.TBL | 2022-01-19 12:52 | 439 | |
![[IMG]](/icons/image2.gif) | Ulenbek, Ford. Lekci..> | 2022-01-19 12:52 | 2.1M | |
![[IMG]](/icons/image2.gif) | Ulenbek, Ford. Lekci..> | 2022-01-19 12:52 | 2.3M | |
![[IMG]](/icons/image2.gif) | Ulenbek, Ford. Lekci..> | 2022-01-19 12:52 | 8.1M | |
![[IMG]](/icons/image2.gif) | Ulenbek, Ford. Lekci..> | 2022-01-19 12:52 | 8.1M | |
![[ ]](/icons/layout.gif) | US DOE Fundamentals ..> | 2022-01-19 12:52 | 2.9M | |
![[ ]](/icons/layout.gif) | US DOE Fundamentals ..> | 2022-01-19 12:52 | 2.9M | |
![[IMG]](/icons/image2.gif) | Winterbone D.E. Adva..> | 2022-01-19 12:52 | 5.3M | |
![[IMG]](/icons/image2.gif) | Wolf-Gladrow D.A. La..> | 2022-01-19 12:52 | 2.0M | |
![[IMG]](/icons/image2.gif) | Wolfram S. Statistic..> | 2022-01-19 12:52 | 787K | |
![[IMG]](/icons/image2.gif) | Wolfram Statistical...> | 2022-01-19 12:52 | 787K | |
![[IMG]](/icons/image2.gif) | Zel'dovich, Rajzer. ..> | 2022-01-19 12:52 | 567K | |
![[IMG]](/icons/image2.gif) | Боголюбов Введение.djvu | 2022-01-19 12:52 | 3.5M | |
![[IMG]](/icons/image2.gif) | Болгарский Термодина..> | 2022-01-19 12:52 | 4.7M | |
![[IMG]](/icons/image2.gif) | Изюмов Статистическа..> | 2022-01-19 12:52 | 3.7M | |
![[IMG]](/icons/image2.gif) | Исихара Статистическ..> | 2022-01-19 12:52 | 3.5M | |
![[IMG]](/icons/image2.gif) | Кац Вероятность.djv | 2022-01-19 12:52 | 2.3M | |
![[IMG]](/icons/image2.gif) | Киттель Элементарная..> | 2022-01-19 12:52 | 2.8M | |
![[IMG]](/icons/image2.gif) | Крайнов Качественные..> | 2022-01-19 12:52 | 1.5M | |
![[IMG]](/icons/image2.gif) | Крылов Работы.djvu | 2022-01-19 12:52 | 1.6M | |
![[IMG]](/icons/image2.gif) | Лифшиц Введние.djvu | 2022-01-19 12:52 | 8.0M | |
![[IMG]](/icons/image2.gif) | Рюэль Статистическая..> | 2022-01-19 12:52 | 3.2M | |
![[IMG]](/icons/image2.gif) | Уленбек Лекции.djvu | 2022-01-19 12:52 | 8.1M | |
![[ ]](/icons/compressed.gif) | Хинчин Математически..> | 2022-01-19 12:52 | 511K | |
![[DIR]](/icons/folder.gif) | E.T.Jaynes/ | 2022-03-26 02:00 | - | |
|